Skip to main content

Biggest Single Number

LeetCode 619 | Difficulty: Easy​

Easy

Problem Description​

Table: MyNumbers

+-------------+------+
| Column Name | Type |
+-------------+------+
| num | int |
+-------------+------+
This table may contain duplicates (In other words, there is no primary key for this table in SQL).
Each row of this table contains an integer.

A single number is a number that appeared only once in the MyNumbers table.

Find the largest single number. If there is no single number, report null.

The result format is in the following example.

Example 1:

Input:
MyNumbers table:
+-----+
| num |
+-----+
| 8 |
| 8 |
| 3 |
| 3 |
| 1 |
| 4 |
| 5 |
| 6 |
+-----+
Output:
+-----+
| num |
+-----+
| 6 |
+-----+
Explanation: The single numbers are 1, 4, 5, and 6.
Since 6 is the largest single number, we return it.

Example 2:

Input:
MyNumbers table:
+-----+
| num |
+-----+
| 8 |
| 8 |
| 7 |
| 7 |
| 3 |
| 3 |
| 3 |
+-----+
Output:
+------+
| num |
+------+
| null |
+------+
Explanation: There are no single numbers in the input table so we return null.

Topics: Database


Approach​

Direct Approach​

This problem can typically be solved with straightforward iteration or simple data structure usage. Focus on correctness first, then optimize.

When to use

Basic problems that test fundamental programming skills.


Solutions​

Solution 1: MySQL (Best: 403 ms)​

MetricValue
Runtime403 ms
MemoryN/A
Date2018-05-08
Solution
# Write your MySQL query statement below

select (select num from number group by num having count(*) = 1 order by num desc limit 1) as num

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.